About 4-morpholin-4-yl-2-[6-(trifluoromethyl)-1H-indol-4-yl]-[1]benzofuro[3,2-d]pyrimidine
4-morpholin-4-yl-2-[6-(trifluoromethyl)-1H-indol-4-yl]-[1]benzofuro[3,2-d]pyrimidine (PubChem CID 58507695) has the molecular formula C23H17F3N4O2
and a molecular weight of 438.41 g/mol. Its IUPAC name is 4-morpholin-4-yl-2-[6-(trifluoromethyl)-1H-indol-4-yl]-[1]benzofuro[3,2-d]pyrimidine.
Molecular Properties
| Compound Name | 4-morpholin-4-yl-2-[6-(trifluoromethyl)-1H-indol-4-yl]-[1]benzofuro[3,2-d]pyrimidine |
| PubChem CID | 58507695 |
| Molecular Formula | C23H17F3N4O2 |
| Molecular Weight | 438.41 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 4-morpholin-4-yl-2-[6-(trifluoromethyl)-1H-indol-4-yl]-[1]benzofuro[3,2-d]pyrimidine |
| SMILES | FC(F)(F)c1cc(-c2nc(N3CCOCC3)c3oc4ccccc4c3n2)c2cc[nH]c2c1 |
| InChI | InChI=1S/C23H17F3N4O2/c24-23(25,26)13-11-16(14-5-6-27-17(14)12-13)21-28-19-15-3-1-2-4-18(15)32-20(19)22(29-21)30-7-9-31-10-8-30/h1-6,11-12,27H,7-10H2 |
| InChIKey | AQVDEEFFRFOCFH-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 67.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.41 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-morpholin-4-yl-2-[6-(trifluoromethyl)-1H-indol-4-yl]-[1]benzofuro[3,2-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-morpholin-4-yl-2-[6-(trifluoromethyl)-1H-indol-4-yl]-[1]benzofuro[3,2-d]pyrimidine?
The IUPAC name of 4-morpholin-4-yl-2-[6-(trifluoromethyl)-1H-indol-4-yl]-[1]benzofuro[3,2-d]pyrimidine (CID 58507695) is 4-morpholin-4-yl-2-[6-(trifluoromethyl)-1H-indol-4-yl]-[1]benzofuro[3,2-d]pyrimidine.
What is the SMILES notation for 4-morpholin-4-yl-2-[6-(trifluoromethyl)-1H-indol-4-yl]-[1]benzofuro[3,2-d]pyrimidine?
The canonical SMILES for 4-morpholin-4-yl-2-[6-(trifluoromethyl)-1H-indol-4-yl]-[1]benzofuro[3,2-d]pyrimidine is FC(F)(F)c1cc(-c2nc(N3CCOCC3)c3oc4ccccc4c3n2)c2cc[nH]c2c1.
What is the InChIKey of 4-morpholin-4-yl-2-[6-(trifluoromethyl)-1H-indol-4-yl]-[1]benzofuro[3,2-d]pyrimidine?
The InChIKey is AQVDEEFFRFOCFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17F3N4O2/c24-23(25,26)13-11-16(14-5-6-27-17(14)12-13)21-28-19-15-3-1-2-4-18(15)32-20(19)22(29-21)30-7-9-31-10-8-30/h1-6,11-12,27H,7-10H2.
What are the key properties of 4-morpholin-4-yl-2-[6-(trifluoromethyl)-1H-indol-4-yl]-[1]benzofuro[3,2-d]pyrimidine?
4-morpholin-4-yl-2-[6-(trifluoromethyl)-1H-indol-4-yl]-[1]benzofuro[3,2-d]pyrimidine has a molecular weight of 438.41 g/mol, XLogP of 5.38, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-morpholin-4-yl-2-[6-(trifluoromethyl)-1H-indol-4-yl]-[1]benzofuro[3,2-d]pyrimidine is sourced from PubChem (CID 58507695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).