C17H20F3N7O2 — CID 58507717
Bimiralisib (PubChem CID 58507717) has the molecular formula C17H20F3N7O2 and a molecular weight of 411.40 g/mol. Its IUPAC name is 5-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | Bimiralisib |
|---|---|
| PubChem CID | 58507717 |
| Molecular Formula | C17H20F3N7O2 |
| Molecular Weight | 411.40 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 5-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | C1COCCN1C2=NC(=NC(=N2)C3=CN=C(C=C3C(F)(F)F)N)N4CCOCC4 |
| InChI | InChI=1S/C17H20F3N7O2/c18-17(19,20)12-9-13(21)22-10-11(12)14-23-15(26-1-5-28-6-2-26)25-16(24-14)27-3-7-29-8-4-27/h9-10H,1-8H2,(H2,21,22) |
| InChIKey | ADGGYDAFIHSYFI-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 103.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | 506 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.40 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |