C18H22F3N9O2 — CID 58507837
2-[5-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-4-(trifluoromethyl)-2-pyridinyl]guanidine (PubChem CID 58507837) has the molecular formula C18H22F3N9O2 and a molecular weight of 453.43 g/mol. Its IUPAC name is 2-[5-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-4-(trifluoromethyl)-2-pyridinyl]guanidine.
| Compound Name | 2-[5-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-4-(trifluoromethyl)-2-pyridinyl]guanidine |
|---|---|
| PubChem CID | 58507837 |
| Molecular Formula | C18H22F3N9O2 |
| Molecular Weight | 453.43 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 2-[5-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-4-(trifluoromethyl)-2-pyridinyl]guanidine |
| SMILES | NC(N)=Nc1cc(C(F)(F)F)c(-c2nc(N3CCOCC3)nc(N3CCOCC3)n2)cn1 |
| InChI | InChI=1S/C18H22F3N9O2/c19-18(20,21)12-9-13(25-15(22)23)24-10-11(12)14-26-16(29-1-5-31-6-2-29)28-17(27-14)30-3-7-32-8-4-30/h9-10H,1-8H2,(H4,22,23,24,25) |
| InChIKey | OPAIYKUWIXJBFK-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 140.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.43 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|