C16H22N8O2 — CID 58508197
5-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-4-methylpyrimidin-2-amine (PubChem CID 58508197) has the molecular formula C16H22N8O2 and a molecular weight of 358.41 g/mol. Its IUPAC name is 5-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-4-methylpyrimidin-2-amine.
| Compound Name | 5-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-4-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 58508197 |
| Molecular Formula | C16H22N8O2 |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 5-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-4-methylpyrimidin-2-amine |
| SMILES | Cc1nc(N)ncc1-c1nc(N2CCOCC2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C16H22N8O2/c1-11-12(10-18-14(17)19-11)13-20-15(23-2-6-25-7-3-23)22-16(21-13)24-4-8-26-9-5-24/h10H,2-9H2,1H3,(H2,17,18,19) |
| InChIKey | WDFOQWYGTLNGLU-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 115.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |