C26H29N5O6 — CID 58508284
2-[2-[2-[4-(3-hydroxyphenyl)-6-morpholin-4-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]ethoxy]ethoxy]-N-methylacetamide (PubChem CID 58508284) has the molecular formula C26H29N5O6 and a molecular weight of 507.55 g/mol. Its IUPAC name is 2-[2-[2-[4-(3-hydroxyphenyl)-6-morpholin-4-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]ethoxy]ethoxy]-N-methylacetamide.
| Compound Name | 2-[2-[2-[4-(3-hydroxyphenyl)-6-morpholin-4-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]ethoxy]ethoxy]-N-methylacetamide |
|---|---|
| PubChem CID | 58508284 |
| Molecular Formula | C26H29N5O6 |
| Molecular Weight | 507.55 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | 2-[2-[2-[4-(3-hydroxyphenyl)-6-morpholin-4-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]ethoxy]ethoxy]-N-methylacetamide |
| SMILES | CNC(=O)COCCOCCc1ccc2c(n1)oc1c(N3CCOCC3)nc(-c3cccc(O)c3)nc12 |
| InChI | InChI=1S/C26H29N5O6/c1-27-21(33)16-36-14-13-34-10-7-18-5-6-20-22-23(37-26(20)28-18)25(31-8-11-35-12-9-31)30-24(29-22)17-3-2-4-19(32)15-17/h2-6,15,32H,7-14,16H2,1H3,(H,27,33) |
| InChIKey | NEASJRVCONSKLD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 132.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.55 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|