C21H25Cl2N5O3S — CID 58509063
4-amino-3,5-dichloro-N-[4-(2-cyanopyrrol-1-yl)-1-(3-methylpiperidin-1-yl)-1-oxobutan-2-yl]benzenesulfonamide (PubChem CID 58509063) has the molecular formula C21H25Cl2N5O3S and a molecular weight of 498.44 g/mol. Its IUPAC name is 4-amino-3,5-dichloro-N-[4-(2-cyanopyrrol-1-yl)-1-(3-methylpiperidin-1-yl)-1-oxobutan-2-yl]benzenesulfonamide.
| Compound Name | 4-amino-3,5-dichloro-N-[4-(2-cyanopyrrol-1-yl)-1-(3-methylpiperidin-1-yl)-1-oxobutan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 58509063 |
| Molecular Formula | C21H25Cl2N5O3S |
| Molecular Weight | 498.44 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | 4-amino-3,5-dichloro-N-[4-(2-cyanopyrrol-1-yl)-1-(3-methylpiperidin-1-yl)-1-oxobutan-2-yl]benzenesulfonamide |
| SMILES | CC1CCCN(C(=O)C(CCn2cccc2C#N)NS(=O)(=O)c2cc(Cl)c(N)c(Cl)c2)C1 |
| InChI | InChI=1S/C21H25Cl2N5O3S/c1-14-4-2-8-28(13-14)21(29)19(6-9-27-7-3-5-15(27)12-24)26-32(30,31)16-10-17(22)20(25)18(23)11-16/h3,5,7,10-11,14,19,26H,2,4,6,8-9,13,25H2,1H3 |
| InChIKey | STJFVBFBEPDAGK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 121.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|