methyl 4-(5-methyl-1,3-oxazol-2-yl)cyclohexane-1-carboxylate

C12H17NO3 — CID 58509473

IUPACmethyl 4-(5-methyl-1,3-oxazol-2-yl)cyclohexane-1-carboxylate
SMILESCOC(=O)C1CCC(c2ncc(C)o2)CC1
InChIInChI=1S/C12H17NO3/c1-8-7-13-11(16-8)9-3-5-10(6-4-9)12(14)15-2/h7,9-10H,3-6H2,1-2H3
InChIKeyBLMWKHHBBAUPRW-UHFFFAOYSA-N
MW223.27 g/mol
LogP2.43
Rot. Bonds2

About methyl 4-(5-methyl-1,3-oxazol-2-yl)cyclohexane-1-carboxylate

methyl 4-(5-methyl-1,3-oxazol-2-yl)cyclohexane-1-carboxylate (PubChem CID 58509473) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is methyl 4-(5-methyl-1,3-oxazol-2-yl)cyclohexane-1-carboxylate.

Molecular Properties

Compound Namemethyl 4-(5-methyl-1,3-oxazol-2-yl)cyclohexane-1-carboxylate
PubChem CID58509473
Molecular FormulaC12H17NO3
Molecular Weight223.27 g/mol
Exact Mass223.12
IUPAC Namemethyl 4-(5-methyl-1,3-oxazol-2-yl)cyclohexane-1-carboxylate
SMILESCOC(=O)C1CCC(c2ncc(C)o2)CC1
InChIInChI=1S/C12H17NO3/c1-8-7-13-11(16-8)9-3-5-10(6-4-9)12(14)15-2/h7,9-10H,3-6H2,1-2H3
InChIKeyBLMWKHHBBAUPRW-UHFFFAOYSA-N
XLogP2.43
TPSA52.33 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500223.27
LogP ≤ 52.43
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 4-(5-methyl-1,3-oxazol-2-yl)cyclohexane-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(5-methyl-1,3-oxazol-2-yl)cyclohexane-1-carboxylate?
The IUPAC name of methyl 4-(5-methyl-1,3-oxazol-2-yl)cyclohexane-1-carboxylate (CID 58509473) is methyl 4-(5-methyl-1,3-oxazol-2-yl)cyclohexane-1-carboxylate.
What is the SMILES notation for methyl 4-(5-methyl-1,3-oxazol-2-yl)cyclohexane-1-carboxylate?
The canonical SMILES for methyl 4-(5-methyl-1,3-oxazol-2-yl)cyclohexane-1-carboxylate is COC(=O)C1CCC(c2ncc(C)o2)CC1.
What is the InChIKey of methyl 4-(5-methyl-1,3-oxazol-2-yl)cyclohexane-1-carboxylate?
The InChIKey is BLMWKHHBBAUPRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO3/c1-8-7-13-11(16-8)9-3-5-10(6-4-9)12(14)15-2/h7,9-10H,3-6H2,1-2H3.
What are the key properties of methyl 4-(5-methyl-1,3-oxazol-2-yl)cyclohexane-1-carboxylate?
methyl 4-(5-methyl-1,3-oxazol-2-yl)cyclohexane-1-carboxylate has a molecular weight of 223.27 g/mol, XLogP of 2.43, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(5-methyl-1,3-oxazol-2-yl)cyclohexane-1-carboxylate is sourced from PubChem (CID 58509473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).