About 3,4-dihydro-2H-1,4-benzoxazine
3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 585096) has the molecular formula C8H9NO
and a molecular weight of 135.17 g/mol. Its IUPAC name is 3,4-dihydro-2H-1,4-benzoxazine.
Molecular Properties
| Compound Name | 3,4-dihydro-2H-1,4-benzoxazine |
| PubChem CID | 585096 |
| Molecular Formula | C8H9NO |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.07 |
| IUPAC Name | 3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | c1ccc2c(c1)NCCO2 |
| InChI | InChI=1S/C8H9NO/c1-2-4-8-7(3-1)9-5-6-10-8/h1-4,9H,5-6H2 |
| InChIKey | YRLORWPBJZEGBX-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,4-dihydro-2H-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydro-2H-1,4-benzoxazine?
The IUPAC name of 3,4-dihydro-2H-1,4-benzoxazine (CID 585096) is 3,4-dihydro-2H-1,4-benzoxazine.
What is the SMILES notation for 3,4-dihydro-2H-1,4-benzoxazine?
The canonical SMILES for 3,4-dihydro-2H-1,4-benzoxazine is c1ccc2c(c1)NCCO2.
What is the InChIKey of 3,4-dihydro-2H-1,4-benzoxazine?
The InChIKey is YRLORWPBJZEGBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO/c1-2-4-8-7(3-1)9-5-6-10-8/h1-4,9H,5-6H2.
What are the key properties of 3,4-dihydro-2H-1,4-benzoxazine?
3,4-dihydro-2H-1,4-benzoxazine has a molecular weight of 135.17 g/mol, XLogP of 1.49, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydro-2H-1,4-benzoxazine is sourced from PubChem (CID 585096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).