C23H20ClFO2 — CID 58509711
(1R,5S)-3-[5-(4-chloro-2-fluorophenyl)-2-ethylphenyl]-4-hydroxybicyclo[3.2.2]nona-3,6-dien-2-one (PubChem CID 58509711) has the molecular formula C23H20ClFO2 and a molecular weight of 382.86 g/mol. Its IUPAC name is (1R,5S)-3-[5-(4-chloro-2-fluorophenyl)-2-ethylphenyl]-4-hydroxybicyclo[3.2.2]nona-3,6-dien-2-one.
| Compound Name | (1R,5S)-3-[5-(4-chloro-2-fluorophenyl)-2-ethylphenyl]-4-hydroxybicyclo[3.2.2]nona-3,6-dien-2-one |
|---|---|
| PubChem CID | 58509711 |
| Molecular Formula | C23H20ClFO2 |
| Molecular Weight | 382.86 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | (1R,5S)-3-[5-(4-chloro-2-fluorophenyl)-2-ethylphenyl]-4-hydroxybicyclo[3.2.2]nona-3,6-dien-2-one |
| SMILES | CCc1ccc(-c2ccc(Cl)cc2F)cc1C1=C(O)[C@@H]2C=C[C@@H](CC2)C1=O |
| InChI | InChI=1S/C23H20ClFO2/c1-2-13-3-8-16(18-10-9-17(24)12-20(18)25)11-19(13)21-22(26)14-4-5-15(7-6-14)23(21)27/h3-5,8-12,14-15,26H,2,6-7H2,1H3/t14-,15+/m1/s1 |
| InChIKey | PSIPOSQJOMBADF-CABCVRRESA-N |
| XLogP | 6.14 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.86 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|