C29H12F4N4 — CID 58509775
[(6E)-1,2,3,4-tetrafluoro-6-isocyanoimino-8-(3-methylphenyl)indeno[1,2-b]fluoren-12-ylidene]cyanamide (PubChem CID 58509775) has the molecular formula C29H12F4N4 and a molecular weight of 492.44 g/mol. Its IUPAC name is [(6E)-1,2,3,4-tetrafluoro-6-isocyanoimino-8-(3-methylphenyl)indeno[1,2-b]fluoren-12-ylidene]cyanamide.
| Compound Name | [(6E)-1,2,3,4-tetrafluoro-6-isocyanoimino-8-(3-methylphenyl)indeno[1,2-b]fluoren-12-ylidene]cyanamide |
|---|---|
| PubChem CID | 58509775 |
| Molecular Formula | C29H12F4N4 |
| Molecular Weight | 492.44 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | [(6E)-1,2,3,4-tetrafluoro-6-isocyanoimino-8-(3-methylphenyl)indeno[1,2-b]fluoren-12-ylidene]cyanamide |
| SMILES | [C-]#[N+]/N=c1\c2cc(-c3cccc(C)c3)ccc2c2cc3/c(=N\C#N)c4c(F)c(F)c(F)c(F)c4c3cc12 |
| InChI | InChI=1S/C29H12F4N4/c1-13-4-3-5-14(8-13)15-6-7-16-17-10-21-18(11-20(17)28(37-35-2)19(16)9-15)22-23(29(21)36-12-34)25(31)27(33)26(32)24(22)30/h3-11H,1H3/b36-29+,37-28+ |
| InChIKey | ODOSGUGIYDGQMR-JNPBCREMSA-N |
| XLogP | 6.82 |
| TPSA | 52.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.44 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|