C22H6F4N4 — CID 58509776
[(6Z)-2,4,8,10-tetrafluoro-6-isocyanoiminoindeno[1,2-b]fluoren-12-ylidene]cyanamide (PubChem CID 58509776) has the molecular formula C22H6F4N4 and a molecular weight of 402.31 g/mol. Its IUPAC name is [(6Z)-2,4,8,10-tetrafluoro-6-isocyanoiminoindeno[1,2-b]fluoren-12-ylidene]cyanamide.
| Compound Name | [(6Z)-2,4,8,10-tetrafluoro-6-isocyanoiminoindeno[1,2-b]fluoren-12-ylidene]cyanamide |
|---|---|
| PubChem CID | 58509776 |
| Molecular Formula | C22H6F4N4 |
| Molecular Weight | 402.31 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | [(6Z)-2,4,8,10-tetrafluoro-6-isocyanoiminoindeno[1,2-b]fluoren-12-ylidene]cyanamide |
| SMILES | [C-]#[N+]/N=c1/c2cc3c(cc2c2c(F)cc(F)cc12)/c(=N/C#N)c1cc(F)cc(F)c13 |
| InChI | InChI=1S/C22H6F4N4/c1-28-30-22-14-7-11-13(6-12(14)20-16(22)3-10(24)5-18(20)26)21(29-8-27)15-2-9(23)4-17(25)19(11)15/h2-7H/b29-21-,30-22- |
| InChIKey | RARIFPLCVLVOER-DHQAUHHZSA-N |
| XLogP | 4.85 |
| TPSA | 52.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.31 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|