C22H2F8N4 — CID 58509779
[(6Z)-1,2,3,4,7,8,9,10-octafluoro-6-isocyanoiminoindeno[1,2-b]fluoren-12-ylidene]cyanamide (PubChem CID 58509779) has the molecular formula C22H2F8N4 and a molecular weight of 474.27 g/mol. Its IUPAC name is [(6Z)-1,2,3,4,7,8,9,10-octafluoro-6-isocyanoiminoindeno[1,2-b]fluoren-12-ylidene]cyanamide.
| Compound Name | [(6Z)-1,2,3,4,7,8,9,10-octafluoro-6-isocyanoiminoindeno[1,2-b]fluoren-12-ylidene]cyanamide |
|---|---|
| PubChem CID | 58509779 |
| Molecular Formula | C22H2F8N4 |
| Molecular Weight | 474.27 g/mol |
| Exact Mass | 474.02 |
| IUPAC Name | [(6Z)-1,2,3,4,7,8,9,10-octafluoro-6-isocyanoiminoindeno[1,2-b]fluoren-12-ylidene]cyanamide |
| SMILES | [C-]#[N+]/N=c1/c2cc3c(cc2c2c(F)c(F)c(F)c(F)c12)/c(=N\C#N)c1c(F)c(F)c(F)c(F)c13 |
| InChI | InChI=1S/C22H2F8N4/c1-32-34-22-8-3-5-7(2-6(8)10-12(22)16(26)20(30)18(28)14(10)24)21(33-4-31)11-9(5)13(23)17(27)19(29)15(11)25/h2-3H/b33-21+,34-22- |
| InChIKey | VWOYEXZNVCBMJA-WNSQVWEDSA-N |
| XLogP | 5.40 |
| TPSA | 52.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.27 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|