C38H20F6N4 — CID 58509802
[(6E)-2-[3,5-bis(trifluoromethyl)phenyl]-8-(3,5-dimethylphenyl)-6-isocyanoiminoindeno[1,2-b]fluoren-12-ylidene]cyanamide (PubChem CID 58509802) has the molecular formula C38H20F6N4 and a molecular weight of 646.59 g/mol. Its IUPAC name is [(6E)-2-[3,5-bis(trifluoromethyl)phenyl]-8-(3,5-dimethylphenyl)-6-isocyanoiminoindeno[1,2-b]fluoren-12-ylidene]cyanamide.
| Compound Name | [(6E)-2-[3,5-bis(trifluoromethyl)phenyl]-8-(3,5-dimethylphenyl)-6-isocyanoiminoindeno[1,2-b]fluoren-12-ylidene]cyanamide |
|---|---|
| PubChem CID | 58509802 |
| Molecular Formula | C38H20F6N4 |
| Molecular Weight | 646.59 g/mol |
| Exact Mass | 646.16 |
| IUPAC Name | [(6E)-2-[3,5-bis(trifluoromethyl)phenyl]-8-(3,5-dimethylphenyl)-6-isocyanoiminoindeno[1,2-b]fluoren-12-ylidene]cyanamide |
| SMILES | [C-]#[N+]/N=c1\c2cc(-c3cc(C)cc(C)c3)ccc2c2cc3/c(=N/C#N)c4cc(-c5cc(C(F)(F)F)cc(C(F)(F)F)c5)ccc4c3cc12 |
| InChI | InChI=1S/C38H20F6N4/c1-19-8-20(2)10-23(9-19)21-4-7-28-30-16-33-29(17-34(30)36(48-46-3)32(28)14-21)27-6-5-22(13-31(27)35(33)47-18-45)24-11-25(37(39,40)41)15-26(12-24)38(42,43)44/h4-17H,1-2H3/b47-35+,48-36+ |
| InChIKey | HOOASPDMSLCSEV-MMXWPCHCSA-N |
| XLogP | 10.28 |
| TPSA | 52.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.59 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|