C38H8F10N4 — CID 58509815
(2E)-2-[(12Z)-12-[cyano(isocyano)methylidene]-2,8-bis(2,3,4,5,6-pentafluorophenyl)indeno[1,2-b]fluoren-6-ylidene]-2-isocyanoacetonitrile (PubChem CID 58509815) has the molecular formula C38H8F10N4 and a molecular weight of 710.49 g/mol. Its IUPAC name is (2E)-2-[(12Z)-12-[cyano(isocyano)methylidene]-2,8-bis(2,3,4,5,6-pentafluorophenyl)indeno[1,2-b]fluoren-6-ylidene]-2-isocyanoacetonitrile.
| Compound Name | (2E)-2-[(12Z)-12-[cyano(isocyano)methylidene]-2,8-bis(2,3,4,5,6-pentafluorophenyl)indeno[1,2-b]fluoren-6-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 58509815 |
| Molecular Formula | C38H8F10N4 |
| Molecular Weight | 710.49 g/mol |
| Exact Mass | 710.06 |
| IUPAC Name | (2E)-2-[(12Z)-12-[cyano(isocyano)methylidene]-2,8-bis(2,3,4,5,6-pentafluorophenyl)indeno[1,2-b]fluoren-6-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1/c2cc(-c3c(F)c(F)c(F)c(F)c3F)ccc2-c2cc3c(cc21)-c1ccc(-c2c(F)c(F)c(F)c(F)c2F)cc1/C3=C(/C#N)[N+]#[C-] |
| InChI | InChI=1S/C38H8F10N4/c1-51-23(11-49)27-19-7-13(25-29(39)33(43)37(47)34(44)30(25)40)3-5-15(19)17-10-22-18(9-21(17)27)16-6-4-14(8-20(16)28(22)24(12-50)52-2)26-31(41)35(45)38(48)36(46)32(26)42/h3-10H/b27-23-,28-24+ |
| InChIKey | VZZILJBSOMEBJP-VRQWBOTBSA-N |
| XLogP | 10.78 |
| TPSA | 56.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.49 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|