C24H21FN2O — CID 58510088
5-[[4-[5-(4-fluorophenyl)-1H-pyrrol-3-yl]-2-methylphenoxy]methyl]-2-methylpyridine (PubChem CID 58510088) has the molecular formula C24H21FN2O and a molecular weight of 372.44 g/mol. Its IUPAC name is 5-[[4-[5-(4-fluorophenyl)-1H-pyrrol-3-yl]-2-methylphenoxy]methyl]-2-methylpyridine.
| Compound Name | 5-[[4-[5-(4-fluorophenyl)-1H-pyrrol-3-yl]-2-methylphenoxy]methyl]-2-methylpyridine |
|---|---|
| PubChem CID | 58510088 |
| Molecular Formula | C24H21FN2O |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 5-[[4-[5-(4-fluorophenyl)-1H-pyrrol-3-yl]-2-methylphenoxy]methyl]-2-methylpyridine |
| SMILES | Cc1ccc(COc2ccc(-c3c[nH]c(-c4ccc(F)cc4)c3)cc2C)cn1 |
| InChI | InChI=1S/C24H21FN2O/c1-16-11-20(7-10-24(16)28-15-18-4-3-17(2)26-13-18)21-12-23(27-14-21)19-5-8-22(25)9-6-19/h3-14,27H,15H2,1-2H3 |
| InChIKey | ZPWLKQLGCQJKFS-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |