About (E,3S)-4,6-dimethyl-6-tri(propan-2-yl)silyloxyhept-4-en-1-yn-3-ol
(E,3S)-4,6-dimethyl-6-tri(propan-2-yl)silyloxyhept-4-en-1-yn-3-ol (PubChem CID 58510383) has the molecular formula C18H34O2Si
and a molecular weight of 310.55 g/mol. Its IUPAC name is (E,3S)-4,6-dimethyl-6-tri(propan-2-yl)silyloxyhept-4-en-1-yn-3-ol.
Molecular Properties
| Compound Name | (E,3S)-4,6-dimethyl-6-tri(propan-2-yl)silyloxyhept-4-en-1-yn-3-ol |
| PubChem CID | 58510383 |
| Molecular Formula | C18H34O2Si |
| Molecular Weight | 310.55 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | (E,3S)-4,6-dimethyl-6-tri(propan-2-yl)silyloxyhept-4-en-1-yn-3-ol |
| SMILES | C#C[C@H](O)/C(C)=C/C(C)(C)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H34O2Si/c1-11-17(19)16(8)12-18(9,10)20-21(13(2)3,14(4)5)15(6)7/h1,12-15,17,19H,2-10H3/b16-12+/t17-/m0/s1 |
| InChIKey | WSGOROFBNWWGEA-MOKGIYGOSA-N |
| XLogP | 4.90 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.55 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (E,3S)-4,6-dimethyl-6-tri(propan-2-yl)silyloxyhept-4-en-1-yn-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,3S)-4,6-dimethyl-6-tri(propan-2-yl)silyloxyhept-4-en-1-yn-3-ol?
The IUPAC name of (E,3S)-4,6-dimethyl-6-tri(propan-2-yl)silyloxyhept-4-en-1-yn-3-ol (CID 58510383) is (E,3S)-4,6-dimethyl-6-tri(propan-2-yl)silyloxyhept-4-en-1-yn-3-ol.
What is the SMILES notation for (E,3S)-4,6-dimethyl-6-tri(propan-2-yl)silyloxyhept-4-en-1-yn-3-ol?
The canonical SMILES for (E,3S)-4,6-dimethyl-6-tri(propan-2-yl)silyloxyhept-4-en-1-yn-3-ol is C#C[C@H](O)/C(C)=C/C(C)(C)O[Si](C(C)C)(C(C)C)C(C)C.
What is the InChIKey of (E,3S)-4,6-dimethyl-6-tri(propan-2-yl)silyloxyhept-4-en-1-yn-3-ol?
The InChIKey is WSGOROFBNWWGEA-MOKGIYGOSA-N. The full InChI is InChI=1S/C18H34O2Si/c1-11-17(19)16(8)12-18(9,10)20-21(13(2)3,14(4)5)15(6)7/h1,12-15,17,19H,2-10H3/b16-12+/t17-/m0/s1.
What are the key properties of (E,3S)-4,6-dimethyl-6-tri(propan-2-yl)silyloxyhept-4-en-1-yn-3-ol?
(E,3S)-4,6-dimethyl-6-tri(propan-2-yl)silyloxyhept-4-en-1-yn-3-ol has a molecular weight of 310.55 g/mol, XLogP of 4.90, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E,3S)-4,6-dimethyl-6-tri(propan-2-yl)silyloxyhept-4-en-1-yn-3-ol is sourced from PubChem (CID 58510383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).