About carbanide;chlororuthenium(1+);4-ethyl-2-(4-ethyl-2-pyridinyl)pyridine
carbanide;chlororuthenium(1+);4-ethyl-2-(4-ethyl-2-pyridinyl)pyridine (PubChem CID 58510490) has the molecular formula C15H19ClN2Ru
and a molecular weight of 363.85 g/mol. Its IUPAC name is carbanide;chlororuthenium(1+);4-ethyl-2-(4-ethyl-2-pyridinyl)pyridine.
Molecular Properties
| Compound Name | carbanide;chlororuthenium(1+);4-ethyl-2-(4-ethyl-2-pyridinyl)pyridine |
| PubChem CID | 58510490 |
| Molecular Formula | C15H19ClN2Ru |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | carbanide;chlororuthenium(1+);4-ethyl-2-(4-ethyl-2-pyridinyl)pyridine |
| SMILES | CCc1ccnc(-c2cc(CC)ccn2)c1.Cl[Ru+].[CH3-] |
| InChI | InChI=1S/C14H16N2.CH3.ClH.Ru/c1-3-11-5-7-15-13(9-11)14-10-12(4-2)6-8-16-14;;;/h5-10H,3-4H2,1-2H3;1H3;1H;/q;-1;;+2/p-1 |
| InChIKey | YGTVIRPKTRSBKF-UHFFFAOYSA-M |
| XLogP | 4.41 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;chlororuthenium(1+);4-ethyl-2-(4-ethyl-2-pyridinyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;chlororuthenium(1+);4-ethyl-2-(4-ethyl-2-pyridinyl)pyridine?
The IUPAC name of carbanide;chlororuthenium(1+);4-ethyl-2-(4-ethyl-2-pyridinyl)pyridine (CID 58510490) is carbanide;chlororuthenium(1+);4-ethyl-2-(4-ethyl-2-pyridinyl)pyridine.
What is the SMILES notation for carbanide;chlororuthenium(1+);4-ethyl-2-(4-ethyl-2-pyridinyl)pyridine?
The canonical SMILES for carbanide;chlororuthenium(1+);4-ethyl-2-(4-ethyl-2-pyridinyl)pyridine is CCc1ccnc(-c2cc(CC)ccn2)c1.Cl[Ru+].[CH3-].
What is the InChIKey of carbanide;chlororuthenium(1+);4-ethyl-2-(4-ethyl-2-pyridinyl)pyridine?
The InChIKey is YGTVIRPKTRSBKF-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H16N2.CH3.ClH.Ru/c1-3-11-5-7-15-13(9-11)14-10-12(4-2)6-8-16-14;;;/h5-10H,3-4H2,1-2H3;1H3;1H;/q;-1;;+2/p-1.
What are the key properties of carbanide;chlororuthenium(1+);4-ethyl-2-(4-ethyl-2-pyridinyl)pyridine?
carbanide;chlororuthenium(1+);4-ethyl-2-(4-ethyl-2-pyridinyl)pyridine has a molecular weight of 363.85 g/mol, XLogP of 4.41, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;chlororuthenium(1+);4-ethyl-2-(4-ethyl-2-pyridinyl)pyridine is sourced from PubChem (CID 58510490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).