About 3-[4-[4-(2,4-difluorophenyl)piperazin-1-yl]butyl]-1,3-benzoxazol-2-one
3-[4-[4-(2,4-difluorophenyl)piperazin-1-yl]butyl]-1,3-benzoxazol-2-one (PubChem CID 58511900) has the molecular formula C21H23F2N3O2
and a molecular weight of 387.43 g/mol. Its IUPAC name is 3-[4-[4-(2,4-difluorophenyl)piperazin-1-yl]butyl]-1,3-benzoxazol-2-one.
Molecular Properties
| Compound Name | 3-[4-[4-(2,4-difluorophenyl)piperazin-1-yl]butyl]-1,3-benzoxazol-2-one |
| PubChem CID | 58511900 |
| Molecular Formula | C21H23F2N3O2 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 3-[4-[4-(2,4-difluorophenyl)piperazin-1-yl]butyl]-1,3-benzoxazol-2-one |
| SMILES | O=c1oc2ccccc2n1CCCCN1CCN(c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C21H23F2N3O2/c22-16-7-8-18(17(23)15-16)25-13-11-24(12-14-25)9-3-4-10-26-19-5-1-2-6-20(19)28-21(26)27/h1-2,5-8,15H,3-4,9-14H2 |
| InChIKey | DDIWZITUFBYTBP-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 41.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-[4-(2,4-difluorophenyl)piperazin-1-yl]butyl]-1,3-benzoxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[4-(2,4-difluorophenyl)piperazin-1-yl]butyl]-1,3-benzoxazol-2-one?
The IUPAC name of 3-[4-[4-(2,4-difluorophenyl)piperazin-1-yl]butyl]-1,3-benzoxazol-2-one (CID 58511900) is 3-[4-[4-(2,4-difluorophenyl)piperazin-1-yl]butyl]-1,3-benzoxazol-2-one.
What is the SMILES notation for 3-[4-[4-(2,4-difluorophenyl)piperazin-1-yl]butyl]-1,3-benzoxazol-2-one?
The canonical SMILES for 3-[4-[4-(2,4-difluorophenyl)piperazin-1-yl]butyl]-1,3-benzoxazol-2-one is O=c1oc2ccccc2n1CCCCN1CCN(c2ccc(F)cc2F)CC1.
What is the InChIKey of 3-[4-[4-(2,4-difluorophenyl)piperazin-1-yl]butyl]-1,3-benzoxazol-2-one?
The InChIKey is DDIWZITUFBYTBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23F2N3O2/c22-16-7-8-18(17(23)15-16)25-13-11-24(12-14-25)9-3-4-10-26-19-5-1-2-6-20(19)28-21(26)27/h1-2,5-8,15H,3-4,9-14H2.
What are the key properties of 3-[4-[4-(2,4-difluorophenyl)piperazin-1-yl]butyl]-1,3-benzoxazol-2-one?
3-[4-[4-(2,4-difluorophenyl)piperazin-1-yl]butyl]-1,3-benzoxazol-2-one has a molecular weight of 387.43 g/mol, XLogP of 3.48, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[4-(2,4-difluorophenyl)piperazin-1-yl]butyl]-1,3-benzoxazol-2-one is sourced from PubChem (CID 58511900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).