C22H31NO6S — CID 58511983
4-[4,4-dimethyl-2-oxo-9-(4-sulfobutyl)-3,9a-dihydro-1H-carbazol-4a-yl]butanoic acid (PubChem CID 58511983) has the molecular formula C22H31NO6S and a molecular weight of 437.56 g/mol. Its IUPAC name is 4-[4,4-dimethyl-2-oxo-9-(4-sulfobutyl)-3,9a-dihydro-1H-carbazol-4a-yl]butanoic acid.
| Compound Name | 4-[4,4-dimethyl-2-oxo-9-(4-sulfobutyl)-3,9a-dihydro-1H-carbazol-4a-yl]butanoic acid |
|---|---|
| PubChem CID | 58511983 |
| Molecular Formula | C22H31NO6S |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 4-[4,4-dimethyl-2-oxo-9-(4-sulfobutyl)-3,9a-dihydro-1H-carbazol-4a-yl]butanoic acid |
| SMILES | CC1(C)CC(=O)CC2N(CCCCS(=O)(=O)O)c3ccccc3C21CCCC(=O)O |
| InChI | InChI=1S/C22H31NO6S/c1-21(2)15-16(24)14-19-22(21,11-7-10-20(25)26)17-8-3-4-9-18(17)23(19)12-5-6-13-30(27,28)29/h3-4,8-9,19H,5-7,10-15H2,1-2H3,(H,25,26)(H,27,28,29) |
| InChIKey | MDPWGZGFRGJPMW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|