C23H33NO5S — CID 58511989
4-[4,4-dimethyl-2-methylidene-9-(4-sulfobutyl)-3,9a-dihydro-1H-carbazol-4a-yl]butanoic acid (PubChem CID 58511989) has the molecular formula C23H33NO5S and a molecular weight of 435.59 g/mol. Its IUPAC name is 4-[4,4-dimethyl-2-methylidene-9-(4-sulfobutyl)-3,9a-dihydro-1H-carbazol-4a-yl]butanoic acid.
| Compound Name | 4-[4,4-dimethyl-2-methylidene-9-(4-sulfobutyl)-3,9a-dihydro-1H-carbazol-4a-yl]butanoic acid |
|---|---|
| PubChem CID | 58511989 |
| Molecular Formula | C23H33NO5S |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | 4-[4,4-dimethyl-2-methylidene-9-(4-sulfobutyl)-3,9a-dihydro-1H-carbazol-4a-yl]butanoic acid |
| SMILES | C=C1CC2N(CCCCS(=O)(=O)O)c3ccccc3C2(CCCC(=O)O)C(C)(C)C1 |
| InChI | InChI=1S/C23H33NO5S/c1-17-15-20-23(22(2,3)16-17,12-8-11-21(25)26)18-9-4-5-10-19(18)24(20)13-6-7-14-30(27,28)29/h4-5,9-10,20H,1,6-8,11-16H2,2-3H3,(H,25,26)(H,27,28,29) |
| InChIKey | BWIDCEMHHGENNH-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|