C19H27NO4S — CID 58511990
4-(4,4,4a-trimethyl-2-oxo-3,9a-dihydro-1H-carbazol-9-yl)butane-1-sulfonic acid (PubChem CID 58511990) has the molecular formula C19H27NO4S and a molecular weight of 365.50 g/mol. Its IUPAC name is 4-(4,4,4a-trimethyl-2-oxo-3,9a-dihydro-1H-carbazol-9-yl)butane-1-sulfonic acid.
| Compound Name | 4-(4,4,4a-trimethyl-2-oxo-3,9a-dihydro-1H-carbazol-9-yl)butane-1-sulfonic acid |
|---|---|
| PubChem CID | 58511990 |
| Molecular Formula | C19H27NO4S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 4-(4,4,4a-trimethyl-2-oxo-3,9a-dihydro-1H-carbazol-9-yl)butane-1-sulfonic acid |
| SMILES | CC1(C)CC(=O)CC2N(CCCCS(=O)(=O)O)c3ccccc3C21C |
| InChI | InChI=1S/C19H27NO4S/c1-18(2)13-14(21)12-17-19(18,3)15-8-4-5-9-16(15)20(17)10-6-7-11-25(22,23)24/h4-5,8-9,17H,6-7,10-13H2,1-3H3,(H,22,23,24) |
| InChIKey | KWBGZPPLNSWZKI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|