C18H15BrN2O2 — CID 58512009
(2-bromo-6,7,8,9-tetrahydro-5H-pyrido[2,3-b]indol-6-yl) benzoate (PubChem CID 58512009) has the molecular formula C18H15BrN2O2 and a molecular weight of 371.23 g/mol. Its IUPAC name is (2-bromo-6,7,8,9-tetrahydro-5H-pyrido[2,3-b]indol-6-yl) benzoate.
| Compound Name | (2-bromo-6,7,8,9-tetrahydro-5H-pyrido[2,3-b]indol-6-yl) benzoate |
|---|---|
| PubChem CID | 58512009 |
| Molecular Formula | C18H15BrN2O2 |
| Molecular Weight | 371.23 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | (2-bromo-6,7,8,9-tetrahydro-5H-pyrido[2,3-b]indol-6-yl) benzoate |
| SMILES | O=C(OC1CCc2[nH]c3nc(Br)ccc3c2C1)c1ccccc1 |
| InChI | InChI=1S/C18H15BrN2O2/c19-16-9-7-13-14-10-12(6-8-15(14)20-17(13)21-16)23-18(22)11-4-2-1-3-5-11/h1-5,7,9,12H,6,8,10H2,(H,20,21) |
| InChIKey | OXNUVSDTWKHCNE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.23 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|