C27H33N5 — CID 58512062
6-N,9-dimethyl-2-N-(3-piperidin-4-yl-1H-inden-5-yl)-5,6,7,8-tetrahydropyrido[2,3-b]indole-2,6-diamine (PubChem CID 58512062) has the molecular formula C27H33N5 and a molecular weight of 427.60 g/mol. Its IUPAC name is 6-N,9-dimethyl-2-N-(3-piperidin-4-yl-1H-inden-5-yl)-5,6,7,8-tetrahydropyrido[2,3-b]indole-2,6-diamine.
| Compound Name | 6-N,9-dimethyl-2-N-(3-piperidin-4-yl-1H-inden-5-yl)-5,6,7,8-tetrahydropyrido[2,3-b]indole-2,6-diamine |
|---|---|
| PubChem CID | 58512062 |
| Molecular Formula | C27H33N5 |
| Molecular Weight | 427.60 g/mol |
| Exact Mass | 427.27 |
| IUPAC Name | 6-N,9-dimethyl-2-N-(3-piperidin-4-yl-1H-inden-5-yl)-5,6,7,8-tetrahydropyrido[2,3-b]indole-2,6-diamine |
| SMILES | CNC1CCc2c(c3ccc(Nc4ccc5c(c4)C(C4CCNCC4)=CC5)nc3n2C)C1 |
| InChI | InChI=1S/C27H33N5/c1-28-19-6-9-25-24(15-19)22-8-10-26(31-27(22)32(25)2)30-20-5-3-17-4-7-21(23(17)16-20)18-11-13-29-14-12-18/h3,5,7-8,10,16,18-19,28-29H,4,6,9,11-15H2,1-2H3,(H,30,31) |
| InChIKey | CVZLDVVYEINYEW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 53.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.60 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |