C23H30N4O3 — CID 58512077
2-N-(3,4-dimethoxyphenyl)-6-N-(2-methoxyethyl)-9-methyl-5,6,7,8-tetrahydropyrido[2,3-b]indole-2,6-diamine (PubChem CID 58512077) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is 2-N-(3,4-dimethoxyphenyl)-6-N-(2-methoxyethyl)-9-methyl-5,6,7,8-tetrahydropyrido[2,3-b]indole-2,6-diamine.
| Compound Name | 2-N-(3,4-dimethoxyphenyl)-6-N-(2-methoxyethyl)-9-methyl-5,6,7,8-tetrahydropyrido[2,3-b]indole-2,6-diamine |
|---|---|
| PubChem CID | 58512077 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 2-N-(3,4-dimethoxyphenyl)-6-N-(2-methoxyethyl)-9-methyl-5,6,7,8-tetrahydropyrido[2,3-b]indole-2,6-diamine |
| SMILES | COCCNC1CCc2c(c3ccc(Nc4ccc(OC)c(OC)c4)nc3n2C)C1 |
| InChI | InChI=1S/C23H30N4O3/c1-27-19-8-5-15(24-11-12-28-2)13-18(19)17-7-10-22(26-23(17)27)25-16-6-9-20(29-3)21(14-16)30-4/h6-7,9-10,14-15,24H,5,8,11-13H2,1-4H3,(H,25,26) |
| InChIKey | LVQRLVCTMHFZNW-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 69.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|