C32H46F2N4O2Si — CID 58512235
tert-butyl N-[2-(3,4-difluoroanilino)-9-tri(propan-2-yl)silyl-5,6,7,8-tetrahydropyrido[2,3-b]indol-6-yl]-N-methylcarbamate (PubChem CID 58512235) has the molecular formula C32H46F2N4O2Si and a molecular weight of 584.83 g/mol. Its IUPAC name is tert-butyl N-[2-(3,4-difluoroanilino)-9-tri(propan-2-yl)silyl-5,6,7,8-tetrahydropyrido[2,3-b]indol-6-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-(3,4-difluoroanilino)-9-tri(propan-2-yl)silyl-5,6,7,8-tetrahydropyrido[2,3-b]indol-6-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 58512235 |
| Molecular Formula | C32H46F2N4O2Si |
| Molecular Weight | 584.83 g/mol |
| Exact Mass | 584.34 |
| IUPAC Name | tert-butyl N-[2-(3,4-difluoroanilino)-9-tri(propan-2-yl)silyl-5,6,7,8-tetrahydropyrido[2,3-b]indol-6-yl]-N-methylcarbamate |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)n1c2c(c3ccc(Nc4ccc(F)c(F)c4)nc31)CC(N(C)C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C32H46F2N4O2Si/c1-19(2)41(20(3)4,21(5)6)38-28-15-12-23(37(10)31(39)40-32(7,8)9)18-25(28)24-13-16-29(36-30(24)38)35-22-11-14-26(33)27(34)17-22/h11,13-14,16-17,19-21,23H,12,15,18H2,1-10H3,(H,35,36) |
| InChIKey | AFQKFCGUHSWDKL-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.83 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|