C22H24FN3O3 — CID 58512248
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-(2-fluoroethoxy)-9-methyl-5,6,7,8-tetrahydropyrido[2,3-b]indol-2-amine (PubChem CID 58512248) has the molecular formula C22H24FN3O3 and a molecular weight of 397.45 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-(2-fluoroethoxy)-9-methyl-5,6,7,8-tetrahydropyrido[2,3-b]indol-2-amine.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-(2-fluoroethoxy)-9-methyl-5,6,7,8-tetrahydropyrido[2,3-b]indol-2-amine |
|---|---|
| PubChem CID | 58512248 |
| Molecular Formula | C22H24FN3O3 |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-(2-fluoroethoxy)-9-methyl-5,6,7,8-tetrahydropyrido[2,3-b]indol-2-amine |
| SMILES | Cn1c2c(c3ccc(Nc4ccc5c(c4)OCCO5)nc31)CC(OCCF)CC2 |
| InChI | InChI=1S/C22H24FN3O3/c1-26-18-5-3-15(27-9-8-23)13-17(18)16-4-7-21(25-22(16)26)24-14-2-6-19-20(12-14)29-11-10-28-19/h2,4,6-7,12,15H,3,5,8-11,13H2,1H3,(H,24,25) |
| InChIKey | PTULWCKUEWIZFG-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 57.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |