About (5-bromo-3-cyclohexylindol-1-yl)thallium;phosphane;sulfanide
(5-bromo-3-cyclohexylindol-1-yl)thallium;phosphane;sulfanide (PubChem CID 58512279) has the molecular formula C14H19BrNPSTl-
and a molecular weight of 548.64 g/mol. Its IUPAC name is (5-bromo-3-cyclohexylindol-1-yl)thallium;phosphane;sulfanide.
Molecular Properties
| Compound Name | (5-bromo-3-cyclohexylindol-1-yl)thallium;phosphane;sulfanide |
| PubChem CID | 58512279 |
| Molecular Formula | C14H19BrNPSTl- |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 547.99 |
| IUPAC Name | (5-bromo-3-cyclohexylindol-1-yl)thallium;phosphane;sulfanide |
| SMILES | Brc1ccc2c(c1)c(C1CCCCC1)cn2[Tl].P.[SH-] |
| InChI | InChI=1S/C14H15BrN.H3P.H2S.Tl/c15-11-6-7-14-12(8-11)13(9-16-14)10-4-2-1-3-5-10;;;/h6-10H,1-5H2;1H3;1H2;/q-1;;;+1/p-1 |
| InChIKey | ABSSAPPHXCNFLQ-UHFFFAOYSA-M |
| XLogP | 4.17 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (5-bromo-3-cyclohexylindol-1-yl)thallium;phosphane;sulfanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-bromo-3-cyclohexylindol-1-yl)thallium;phosphane;sulfanide?
The IUPAC name of (5-bromo-3-cyclohexylindol-1-yl)thallium;phosphane;sulfanide (CID 58512279) is (5-bromo-3-cyclohexylindol-1-yl)thallium;phosphane;sulfanide.
What is the SMILES notation for (5-bromo-3-cyclohexylindol-1-yl)thallium;phosphane;sulfanide?
The canonical SMILES for (5-bromo-3-cyclohexylindol-1-yl)thallium;phosphane;sulfanide is Brc1ccc2c(c1)c(C1CCCCC1)cn2[Tl].P.[SH-].
What is the InChIKey of (5-bromo-3-cyclohexylindol-1-yl)thallium;phosphane;sulfanide?
The InChIKey is ABSSAPPHXCNFLQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H15BrN.H3P.H2S.Tl/c15-11-6-7-14-12(8-11)13(9-16-14)10-4-2-1-3-5-10;;;/h6-10H,1-5H2;1H3;1H2;/q-1;;;+1/p-1.
What are the key properties of (5-bromo-3-cyclohexylindol-1-yl)thallium;phosphane;sulfanide?
(5-bromo-3-cyclohexylindol-1-yl)thallium;phosphane;sulfanide has a molecular weight of 548.64 g/mol, XLogP of 4.17, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-bromo-3-cyclohexylindol-1-yl)thallium;phosphane;sulfanide is sourced from PubChem (CID 58512279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).