C21H23N3O3 — CID 58512299
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-methoxy-9-methyl-5,6,7,8-tetrahydropyrido[2,3-b]indol-2-amine (PubChem CID 58512299) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-methoxy-9-methyl-5,6,7,8-tetrahydropyrido[2,3-b]indol-2-amine.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-methoxy-9-methyl-5,6,7,8-tetrahydropyrido[2,3-b]indol-2-amine |
|---|---|
| PubChem CID | 58512299 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-methoxy-9-methyl-5,6,7,8-tetrahydropyrido[2,3-b]indol-2-amine |
| SMILES | COC1CCc2c(c3ccc(Nc4ccc5c(c4)OCCO5)nc3n2C)C1 |
| InChI | InChI=1S/C21H23N3O3/c1-24-17-6-4-14(25-2)12-16(17)15-5-8-20(23-21(15)24)22-13-3-7-18-19(11-13)27-10-9-26-18/h3,5,7-8,11,14H,4,6,9-10,12H2,1-2H3,(H,22,23) |
| InChIKey | HCBIXBASJCATHY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 57.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |