C37H54N6O2Si — CID 58512530
tert-butyl 4-[6-(6,7,8,9-tetrahydro-5H-pyrido[2,3-b]indol-2-ylamino)-1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridin-3-yl]piperidine-1-carboxylate (PubChem CID 58512530) has the molecular formula C37H54N6O2Si and a molecular weight of 642.97 g/mol. Its IUPAC name is tert-butyl 4-[6-(6,7,8,9-tetrahydro-5H-pyrido[2,3-b]indol-2-ylamino)-1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridin-3-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[6-(6,7,8,9-tetrahydro-5H-pyrido[2,3-b]indol-2-ylamino)-1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridin-3-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58512530 |
| Molecular Formula | C37H54N6O2Si |
| Molecular Weight | 642.97 g/mol |
| Exact Mass | 642.41 |
| IUPAC Name | tert-butyl 4-[6-(6,7,8,9-tetrahydro-5H-pyrido[2,3-b]indol-2-ylamino)-1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridin-3-yl]piperidine-1-carboxylate |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)n1cc(C2CCN(C(=O)OC(C)(C)C)CC2)c2ccc(Nc3ccc4c5c([nH]c4n3)CCCC5)nc21 |
| InChI | InChI=1S/C37H54N6O2Si/c1-23(2)46(24(3)4,25(5)6)43-22-30(26-18-20-42(21-19-26)36(44)45-37(7,8)9)29-15-17-33(41-35(29)43)39-32-16-14-28-27-12-10-11-13-31(27)38-34(28)40-32/h14-17,22-26H,10-13,18-21H2,1-9H3,(H2,38,39,40,41) |
| InChIKey | UQNXYJSWJDAKLZ-UHFFFAOYSA-N |
| XLogP | 9.67 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.97 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|