About 2-amino-3-hydroxy-4,5,6-trimethylbenzaldehyde
2-amino-3-hydroxy-4,5,6-trimethylbenzaldehyde (PubChem CID 58512865) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is 2-amino-3-hydroxy-4,5,6-trimethylbenzaldehyde.
Molecular Properties
| Compound Name | 2-amino-3-hydroxy-4,5,6-trimethylbenzaldehyde |
| PubChem CID | 58512865 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 2-amino-3-hydroxy-4,5,6-trimethylbenzaldehyde |
| SMILES | Cc1c(C)c(O)c(N)c(C=O)c1C |
| InChI | InChI=1S/C10H13NO2/c1-5-6(2)8(4-12)9(11)10(13)7(5)3/h4,13H,11H2,1-3H3 |
| InChIKey | JZVHOENWBMFRTE-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-hydroxy-4,5,6-trimethylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-hydroxy-4,5,6-trimethylbenzaldehyde?
The IUPAC name of 2-amino-3-hydroxy-4,5,6-trimethylbenzaldehyde (CID 58512865) is 2-amino-3-hydroxy-4,5,6-trimethylbenzaldehyde.
What is the SMILES notation for 2-amino-3-hydroxy-4,5,6-trimethylbenzaldehyde?
The canonical SMILES for 2-amino-3-hydroxy-4,5,6-trimethylbenzaldehyde is Cc1c(C)c(O)c(N)c(C=O)c1C.
What is the InChIKey of 2-amino-3-hydroxy-4,5,6-trimethylbenzaldehyde?
The InChIKey is JZVHOENWBMFRTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2/c1-5-6(2)8(4-12)9(11)10(13)7(5)3/h4,13H,11H2,1-3H3.
What are the key properties of 2-amino-3-hydroxy-4,5,6-trimethylbenzaldehyde?
2-amino-3-hydroxy-4,5,6-trimethylbenzaldehyde has a molecular weight of 179.22 g/mol, XLogP of 1.71, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-hydroxy-4,5,6-trimethylbenzaldehyde is sourced from PubChem (CID 58512865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).