About 4-(diethylaminomethyl)-2,5-dimethylphenol
4-(diethylaminomethyl)-2,5-dimethylphenol (PubChem CID 585129) has the molecular formula C13H21NO
and a molecular weight of 207.32 g/mol. Its IUPAC name is 4-(diethylaminomethyl)-2,5-dimethylphenol.
Molecular Properties
| Compound Name | 4-(diethylaminomethyl)-2,5-dimethylphenol |
| PubChem CID | 585129 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 4-(diethylaminomethyl)-2,5-dimethylphenol |
| SMILES | CCN(CC)Cc1cc(C)c(O)cc1C |
| InChI | InChI=1S/C13H21NO/c1-5-14(6-2)9-12-7-11(4)13(15)8-10(12)3/h7-8,15H,5-6,9H2,1-4H3 |
| InChIKey | XWLYWWDJKAPLDA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(diethylaminomethyl)-2,5-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(diethylaminomethyl)-2,5-dimethylphenol?
The IUPAC name of 4-(diethylaminomethyl)-2,5-dimethylphenol (CID 585129) is 4-(diethylaminomethyl)-2,5-dimethylphenol.
What is the SMILES notation for 4-(diethylaminomethyl)-2,5-dimethylphenol?
The canonical SMILES for 4-(diethylaminomethyl)-2,5-dimethylphenol is CCN(CC)Cc1cc(C)c(O)cc1C.
What is the InChIKey of 4-(diethylaminomethyl)-2,5-dimethylphenol?
The InChIKey is XWLYWWDJKAPLDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO/c1-5-14(6-2)9-12-7-11(4)13(15)8-10(12)3/h7-8,15H,5-6,9H2,1-4H3.
What are the key properties of 4-(diethylaminomethyl)-2,5-dimethylphenol?
4-(diethylaminomethyl)-2,5-dimethylphenol has a molecular weight of 207.32 g/mol, XLogP of 2.85, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(diethylaminomethyl)-2,5-dimethylphenol is sourced from PubChem (CID 585129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).