C41H47N3O3S — CID 58513617
[4-[1-(cyclopropylmethyl)-2-(2,2-dimethylpropyl)benzimidazol-5-yl]sulfonyl-1-tritylpiperidin-4-yl]methanol (PubChem CID 58513617) has the molecular formula C41H47N3O3S and a molecular weight of 661.91 g/mol. Its IUPAC name is [4-[1-(cyclopropylmethyl)-2-(2,2-dimethylpropyl)benzimidazol-5-yl]sulfonyl-1-tritylpiperidin-4-yl]methanol.
| Compound Name | [4-[1-(cyclopropylmethyl)-2-(2,2-dimethylpropyl)benzimidazol-5-yl]sulfonyl-1-tritylpiperidin-4-yl]methanol |
|---|---|
| PubChem CID | 58513617 |
| Molecular Formula | C41H47N3O3S |
| Molecular Weight | 661.91 g/mol |
| Exact Mass | 661.33 |
| IUPAC Name | [4-[1-(cyclopropylmethyl)-2-(2,2-dimethylpropyl)benzimidazol-5-yl]sulfonyl-1-tritylpiperidin-4-yl]methanol |
| SMILES | CC(C)(C)Cc1nc2cc(S(=O)(=O)C3(CO)CCN(C(c4ccccc4)(c4ccccc4)c4ccccc4)CC3)ccc2n1CC1CC1 |
| InChI | InChI=1S/C41H47N3O3S/c1-39(2,3)28-38-42-36-27-35(21-22-37(36)44(38)29-31-19-20-31)48(46,47)40(30-45)23-25-43(26-24-40)41(32-13-7-4-8-14-32,33-15-9-5-10-16-33)34-17-11-6-12-18-34/h4-18,21-22,27,31,45H,19-20,23-26,28-30H2,1-3H3 |
| InChIKey | PMLRFFLMVTVYKC-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.91 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|