C17H21NO — CID 58514231
1-(3H-inden-5-yl)-3-piperidin-1-ylpropan-1-one (PubChem CID 58514231) has the molecular formula C17H21NO and a molecular weight of 255.36 g/mol. Its IUPAC name is 1-(3H-inden-5-yl)-3-piperidin-1-ylpropan-1-one.
| Compound Name | 1-(3H-inden-5-yl)-3-piperidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 58514231 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 1-(3H-inden-5-yl)-3-piperidin-1-ylpropan-1-one |
| SMILES | O=C(CCN1CCCCC1)c1ccc2c(c1)CC=C2 |
| InChI | InChI=1S/C17H21NO/c19-17(9-12-18-10-2-1-3-11-18)16-8-7-14-5-4-6-15(14)13-16/h4-5,7-8,13H,1-3,6,9-12H2 |
| InChIKey | QXCCYHGFTFGWHR-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |