About [(2R)-1-imidazo[1,2-a]pyrimidin-5-ylpyrrolidin-2-yl]methanol
[(2R)-1-imidazo[1,2-a]pyrimidin-5-ylpyrrolidin-2-yl]methanol (PubChem CID 58514394) has the molecular formula C11H14N4O
and a molecular weight of 218.26 g/mol. Its IUPAC name is [(2R)-1-imidazo[1,2-a]pyrimidin-5-ylpyrrolidin-2-yl]methanol.
Molecular Properties
| Compound Name | [(2R)-1-imidazo[1,2-a]pyrimidin-5-ylpyrrolidin-2-yl]methanol |
| PubChem CID | 58514394 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | [(2R)-1-imidazo[1,2-a]pyrimidin-5-ylpyrrolidin-2-yl]methanol |
| SMILES | OC[C@H]1CCCN1c1ccnc2nccn12 |
| InChI | InChI=1S/C11H14N4O/c16-8-9-2-1-6-14(9)10-3-4-12-11-13-5-7-15(10)11/h3-5,7,9,16H,1-2,6,8H2/t9-/m1/s1 |
| InChIKey | CPALKMLJWYFYLP-SECBINFHSA-N |
| XLogP | 0.69 |
| TPSA | 53.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(2R)-1-imidazo[1,2-a]pyrimidin-5-ylpyrrolidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-1-imidazo[1,2-a]pyrimidin-5-ylpyrrolidin-2-yl]methanol?
The IUPAC name of [(2R)-1-imidazo[1,2-a]pyrimidin-5-ylpyrrolidin-2-yl]methanol (CID 58514394) is [(2R)-1-imidazo[1,2-a]pyrimidin-5-ylpyrrolidin-2-yl]methanol.
What is the SMILES notation for [(2R)-1-imidazo[1,2-a]pyrimidin-5-ylpyrrolidin-2-yl]methanol?
The canonical SMILES for [(2R)-1-imidazo[1,2-a]pyrimidin-5-ylpyrrolidin-2-yl]methanol is OC[C@H]1CCCN1c1ccnc2nccn12.
What is the InChIKey of [(2R)-1-imidazo[1,2-a]pyrimidin-5-ylpyrrolidin-2-yl]methanol?
The InChIKey is CPALKMLJWYFYLP-SECBINFHSA-N. The full InChI is InChI=1S/C11H14N4O/c16-8-9-2-1-6-14(9)10-3-4-12-11-13-5-7-15(10)11/h3-5,7,9,16H,1-2,6,8H2/t9-/m1/s1.
What are the key properties of [(2R)-1-imidazo[1,2-a]pyrimidin-5-ylpyrrolidin-2-yl]methanol?
[(2R)-1-imidazo[1,2-a]pyrimidin-5-ylpyrrolidin-2-yl]methanol has a molecular weight of 218.26 g/mol, XLogP of 0.69, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-1-imidazo[1,2-a]pyrimidin-5-ylpyrrolidin-2-yl]methanol is sourced from PubChem (CID 58514394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).