C21H16ClF4N5O — CID 58514723
4-[6-[(2-chloro-3,6-difluorophenyl)methylamino]-5-diazenyl-2-pyridinyl]-N-ethyl-2,6-difluorobenzamide (PubChem CID 58514723) has the molecular formula C21H16ClF4N5O and a molecular weight of 465.84 g/mol. Its IUPAC name is 4-[6-[(2-chloro-3,6-difluorophenyl)methylamino]-5-diazenyl-2-pyridinyl]-N-ethyl-2,6-difluorobenzamide.
| Compound Name | 4-[6-[(2-chloro-3,6-difluorophenyl)methylamino]-5-diazenyl-2-pyridinyl]-N-ethyl-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 58514723 |
| Molecular Formula | C21H16ClF4N5O |
| Molecular Weight | 465.84 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | 4-[6-[(2-chloro-3,6-difluorophenyl)methylamino]-5-diazenyl-2-pyridinyl]-N-ethyl-2,6-difluorobenzamide |
| SMILES | [H]/N=N/c1ccc(-c2cc(F)c(C(=O)NCC)c(F)c2)nc1NCc1c(F)ccc(F)c1Cl |
| InChI | InChI=1S/C21H16ClF4N5O/c1-2-28-21(32)18-14(25)7-10(8-15(18)26)16-5-6-17(31-27)20(30-16)29-9-11-12(23)3-4-13(24)19(11)22/h3-8,27H,2,9H2,1H3,(H,28,32)(H,29,30)/b31-27+ |
| InChIKey | KETMQSYWNZBZEQ-TVKQRKNISA-N |
| XLogP | 5.98 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.84 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|