C20H14ClF4N3O2 — CID 58514939
[4-[5-amino-6-[(2-chloro-3,6-difluorophenyl)methylamino]-2-pyridinyl]-2,6-difluorophenyl]methyl formate (PubChem CID 58514939) has the molecular formula C20H14ClF4N3O2 and a molecular weight of 439.80 g/mol. Its IUPAC name is [4-[5-amino-6-[(2-chloro-3,6-difluorophenyl)methylamino]-2-pyridinyl]-2,6-difluorophenyl]methyl formate.
| Compound Name | [4-[5-amino-6-[(2-chloro-3,6-difluorophenyl)methylamino]-2-pyridinyl]-2,6-difluorophenyl]methyl formate |
|---|---|
| PubChem CID | 58514939 |
| Molecular Formula | C20H14ClF4N3O2 |
| Molecular Weight | 439.80 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | [4-[5-amino-6-[(2-chloro-3,6-difluorophenyl)methylamino]-2-pyridinyl]-2,6-difluorophenyl]methyl formate |
| SMILES | Nc1ccc(-c2cc(F)c(COC=O)c(F)c2)nc1NCc1c(F)ccc(F)c1Cl |
| InChI | InChI=1S/C20H14ClF4N3O2/c21-19-11(13(22)1-2-14(19)23)7-27-20-17(26)3-4-18(28-20)10-5-15(24)12(8-30-9-29)16(25)6-10/h1-6,9H,7-8,26H2,(H,27,28) |
| InChIKey | RDTNBOLZEYWHFG-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.80 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|