C26H19F3N6O — CID 58515015
(2R)-4-[4-amino-1-[[2-[2-(trifluoromethyl)phenyl]quinolin-3-yl]methyl]pyrazolo[3,4-d]pyrimidin-3-yl]but-3-yn-2-ol (PubChem CID 58515015) has the molecular formula C26H19F3N6O and a molecular weight of 488.47 g/mol. Its IUPAC name is (2R)-4-[4-amino-1-[[2-[2-(trifluoromethyl)phenyl]quinolin-3-yl]methyl]pyrazolo[3,4-d]pyrimidin-3-yl]but-3-yn-2-ol.
| Compound Name | (2R)-4-[4-amino-1-[[2-[2-(trifluoromethyl)phenyl]quinolin-3-yl]methyl]pyrazolo[3,4-d]pyrimidin-3-yl]but-3-yn-2-ol |
|---|---|
| PubChem CID | 58515015 |
| Molecular Formula | C26H19F3N6O |
| Molecular Weight | 488.47 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | (2R)-4-[4-amino-1-[[2-[2-(trifluoromethyl)phenyl]quinolin-3-yl]methyl]pyrazolo[3,4-d]pyrimidin-3-yl]but-3-yn-2-ol |
| SMILES | C[C@@H](O)C#Cc1nn(Cc2cc3ccccc3nc2-c2ccccc2C(F)(F)F)c2ncnc(N)c12 |
| InChI | InChI=1S/C26H19F3N6O/c1-15(36)10-11-21-22-24(30)31-14-32-25(22)35(34-21)13-17-12-16-6-2-5-9-20(16)33-23(17)18-7-3-4-8-19(18)26(27,28)29/h2-9,12,14-15,36H,13H2,1H3,(H2,30,31,32)/t15-/m1/s1 |
| InChIKey | YCFGRGIDNSXUCY-OAHLLOKOSA-N |
| XLogP | 4.42 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.47 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|