About (3E,5Z)-3-fluoro-2,7-dimethylocta-3,5-diene
(3E,5Z)-3-fluoro-2,7-dimethylocta-3,5-diene (PubChem CID 58515107) has the molecular formula C10H17F
and a molecular weight of 156.24 g/mol. Its IUPAC name is (3E,5Z)-3-fluoro-2,7-dimethylocta-3,5-diene.
Molecular Properties
| Compound Name | (3E,5Z)-3-fluoro-2,7-dimethylocta-3,5-diene |
| PubChem CID | 58515107 |
| Molecular Formula | C10H17F |
| Molecular Weight | 156.24 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | (3E,5Z)-3-fluoro-2,7-dimethylocta-3,5-diene |
| SMILES | CC(C)/C=C\C=C(\F)C(C)C |
| InChI | InChI=1S/C10H17F/c1-8(2)6-5-7-10(11)9(3)4/h5-9H,1-4H3/b6-5-,10-7+ |
| InChIKey | BPTRUJNTRJDORK-ZZWPSLBBSA-N |
| XLogP | 3.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.24 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E,5Z)-3-fluoro-2,7-dimethylocta-3,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,5Z)-3-fluoro-2,7-dimethylocta-3,5-diene?
The IUPAC name of (3E,5Z)-3-fluoro-2,7-dimethylocta-3,5-diene (CID 58515107) is (3E,5Z)-3-fluoro-2,7-dimethylocta-3,5-diene.
What is the SMILES notation for (3E,5Z)-3-fluoro-2,7-dimethylocta-3,5-diene?
The canonical SMILES for (3E,5Z)-3-fluoro-2,7-dimethylocta-3,5-diene is CC(C)/C=C\C=C(\F)C(C)C.
What is the InChIKey of (3E,5Z)-3-fluoro-2,7-dimethylocta-3,5-diene?
The InChIKey is BPTRUJNTRJDORK-ZZWPSLBBSA-N. The full InChI is InChI=1S/C10H17F/c1-8(2)6-5-7-10(11)9(3)4/h5-9H,1-4H3/b6-5-,10-7+.
What are the key properties of (3E,5Z)-3-fluoro-2,7-dimethylocta-3,5-diene?
(3E,5Z)-3-fluoro-2,7-dimethylocta-3,5-diene has a molecular weight of 156.24 g/mol, XLogP of 3.71, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,5Z)-3-fluoro-2,7-dimethylocta-3,5-diene is sourced from PubChem (CID 58515107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).