C22H21F3O3 — CID 58515660
5-hydroxy-2,2,6,6-tetramethyl-4-[2-methyl-5-(3,4,5-trifluorophenyl)phenyl]pyran-3-one (PubChem CID 58515660) has the molecular formula C22H21F3O3 and a molecular weight of 390.40 g/mol. Its IUPAC name is 5-hydroxy-2,2,6,6-tetramethyl-4-[2-methyl-5-(3,4,5-trifluorophenyl)phenyl]pyran-3-one.
| Compound Name | 5-hydroxy-2,2,6,6-tetramethyl-4-[2-methyl-5-(3,4,5-trifluorophenyl)phenyl]pyran-3-one |
|---|---|
| PubChem CID | 58515660 |
| Molecular Formula | C22H21F3O3 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 5-hydroxy-2,2,6,6-tetramethyl-4-[2-methyl-5-(3,4,5-trifluorophenyl)phenyl]pyran-3-one |
| SMILES | Cc1ccc(-c2cc(F)c(F)c(F)c2)cc1C1=C(O)C(C)(C)OC(C)(C)C1=O |
| InChI | InChI=1S/C22H21F3O3/c1-11-6-7-12(13-9-15(23)18(25)16(24)10-13)8-14(11)17-19(26)21(2,3)28-22(4,5)20(17)27/h6-10,26H,1-5H3 |
| InChIKey | WXNWDJIHTPWJOT-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|