C23H25IO3 — CID 58515681
4-[2-ethyl-5-(4-iodophenyl)phenyl]-5-hydroxy-2,2,6,6-tetramethylpyran-3-one (PubChem CID 58515681) has the molecular formula C23H25IO3 and a molecular weight of 476.35 g/mol. Its IUPAC name is 4-[2-ethyl-5-(4-iodophenyl)phenyl]-5-hydroxy-2,2,6,6-tetramethylpyran-3-one.
| Compound Name | 4-[2-ethyl-5-(4-iodophenyl)phenyl]-5-hydroxy-2,2,6,6-tetramethylpyran-3-one |
|---|---|
| PubChem CID | 58515681 |
| Molecular Formula | C23H25IO3 |
| Molecular Weight | 476.35 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | 4-[2-ethyl-5-(4-iodophenyl)phenyl]-5-hydroxy-2,2,6,6-tetramethylpyran-3-one |
| SMILES | CCc1ccc(-c2ccc(I)cc2)cc1C1=C(O)C(C)(C)OC(C)(C)C1=O |
| InChI | InChI=1S/C23H25IO3/c1-6-14-7-8-16(15-9-11-17(24)12-10-15)13-18(14)19-20(25)22(2,3)27-23(4,5)21(19)26/h7-13,25H,6H2,1-5H3 |
| InChIKey | LNTJVSDMHUCDHC-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.35 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|