C23H23ClF2O3 — CID 58515688
4-[5-(4-chloro-2,3-difluorophenyl)-2-ethylphenyl]-5-hydroxy-2,2,6,6-tetramethylpyran-3-one (PubChem CID 58515688) has the molecular formula C23H23ClF2O3 and a molecular weight of 420.88 g/mol. Its IUPAC name is 4-[5-(4-chloro-2,3-difluorophenyl)-2-ethylphenyl]-5-hydroxy-2,2,6,6-tetramethylpyran-3-one.
| Compound Name | 4-[5-(4-chloro-2,3-difluorophenyl)-2-ethylphenyl]-5-hydroxy-2,2,6,6-tetramethylpyran-3-one |
|---|---|
| PubChem CID | 58515688 |
| Molecular Formula | C23H23ClF2O3 |
| Molecular Weight | 420.88 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 4-[5-(4-chloro-2,3-difluorophenyl)-2-ethylphenyl]-5-hydroxy-2,2,6,6-tetramethylpyran-3-one |
| SMILES | CCc1ccc(-c2ccc(Cl)c(F)c2F)cc1C1=C(O)C(C)(C)OC(C)(C)C1=O |
| InChI | InChI=1S/C23H23ClF2O3/c1-6-12-7-8-13(14-9-10-16(24)19(26)18(14)25)11-15(12)17-20(27)22(2,3)29-23(4,5)21(17)28/h7-11,27H,6H2,1-5H3 |
| InChIKey | ZRJPNRSIFUSCIM-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.88 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|