C23H24ClNO3 — CID 58515708
4-[5-(6-chloro-3-pyridinyl)-2-ethylphenyl]-5-hydroxy-2,2,6,6-tetramethylcyclohex-4-ene-1,3-dione (PubChem CID 58515708) has the molecular formula C23H24ClNO3 and a molecular weight of 397.90 g/mol. Its IUPAC name is 4-[5-(6-chloro-3-pyridinyl)-2-ethylphenyl]-5-hydroxy-2,2,6,6-tetramethylcyclohex-4-ene-1,3-dione.
| Compound Name | 4-[5-(6-chloro-3-pyridinyl)-2-ethylphenyl]-5-hydroxy-2,2,6,6-tetramethylcyclohex-4-ene-1,3-dione |
|---|---|
| PubChem CID | 58515708 |
| Molecular Formula | C23H24ClNO3 |
| Molecular Weight | 397.90 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 4-[5-(6-chloro-3-pyridinyl)-2-ethylphenyl]-5-hydroxy-2,2,6,6-tetramethylcyclohex-4-ene-1,3-dione |
| SMILES | CCc1ccc(-c2ccc(Cl)nc2)cc1C1=C(O)C(C)(C)C(=O)C(C)(C)C1=O |
| InChI | InChI=1S/C23H24ClNO3/c1-6-13-7-8-14(15-9-10-17(24)25-12-15)11-16(13)18-19(26)22(2,3)21(28)23(4,5)20(18)27/h7-12,26H,6H2,1-5H3 |
| InChIKey | NOTCGUPDQQIGNO-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.90 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|