C23H22Cl2O3 — CID 58515843
4-[5-(2,4-dichlorophenyl)-2-methylphenyl]-5-hydroxy-2,2,6,6-tetramethylcyclohex-4-ene-1,3-dione (PubChem CID 58515843) has the molecular formula C23H22Cl2O3 and a molecular weight of 417.33 g/mol. Its IUPAC name is 4-[5-(2,4-dichlorophenyl)-2-methylphenyl]-5-hydroxy-2,2,6,6-tetramethylcyclohex-4-ene-1,3-dione.
| Compound Name | 4-[5-(2,4-dichlorophenyl)-2-methylphenyl]-5-hydroxy-2,2,6,6-tetramethylcyclohex-4-ene-1,3-dione |
|---|---|
| PubChem CID | 58515843 |
| Molecular Formula | C23H22Cl2O3 |
| Molecular Weight | 417.33 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 4-[5-(2,4-dichlorophenyl)-2-methylphenyl]-5-hydroxy-2,2,6,6-tetramethylcyclohex-4-ene-1,3-dione |
| SMILES | Cc1ccc(-c2ccc(Cl)cc2Cl)cc1C1=C(O)C(C)(C)C(=O)C(C)(C)C1=O |
| InChI | InChI=1S/C23H22Cl2O3/c1-12-6-7-13(15-9-8-14(24)11-17(15)25)10-16(12)18-19(26)22(2,3)21(28)23(4,5)20(18)27/h6-11,26H,1-5H3 |
| InChIKey | UNGWONXUUNBPAP-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.33 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|