C23H22ClFO3 — CID 58515912
4-[5-(4-chloro-3-fluorophenyl)-2-methylphenyl]-5-hydroxy-2,2,6,6-tetramethylcyclohex-4-ene-1,3-dione (PubChem CID 58515912) has the molecular formula C23H22ClFO3 and a molecular weight of 400.88 g/mol. Its IUPAC name is 4-[5-(4-chloro-3-fluorophenyl)-2-methylphenyl]-5-hydroxy-2,2,6,6-tetramethylcyclohex-4-ene-1,3-dione.
| Compound Name | 4-[5-(4-chloro-3-fluorophenyl)-2-methylphenyl]-5-hydroxy-2,2,6,6-tetramethylcyclohex-4-ene-1,3-dione |
|---|---|
| PubChem CID | 58515912 |
| Molecular Formula | C23H22ClFO3 |
| Molecular Weight | 400.88 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 4-[5-(4-chloro-3-fluorophenyl)-2-methylphenyl]-5-hydroxy-2,2,6,6-tetramethylcyclohex-4-ene-1,3-dione |
| SMILES | Cc1ccc(-c2ccc(Cl)c(F)c2)cc1C1=C(O)C(C)(C)C(=O)C(C)(C)C1=O |
| InChI | InChI=1S/C23H22ClFO3/c1-12-6-7-13(14-8-9-16(24)17(25)11-14)10-15(12)18-19(26)22(2,3)21(28)23(4,5)20(18)27/h6-11,26H,1-5H3 |
| InChIKey | CTIACIJXZOFTAV-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.88 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|