About 4-bromo-1-(1,4-dioxaspiro[4.5]decan-8-yl)-3-(trifluoromethyl)pyrazole
4-bromo-1-(1,4-dioxaspiro[4.5]decan-8-yl)-3-(trifluoromethyl)pyrazole (PubChem CID 58516047) has the molecular formula C12H14BrF3N2O2
and a molecular weight of 355.15 g/mol. Its IUPAC name is 4-bromo-1-(1,4-dioxaspiro[4.5]decan-8-yl)-3-(trifluoromethyl)pyrazole.
Molecular Properties
| Compound Name | 4-bromo-1-(1,4-dioxaspiro[4.5]decan-8-yl)-3-(trifluoromethyl)pyrazole |
| PubChem CID | 58516047 |
| Molecular Formula | C12H14BrF3N2O2 |
| Molecular Weight | 355.15 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | 4-bromo-1-(1,4-dioxaspiro[4.5]decan-8-yl)-3-(trifluoromethyl)pyrazole |
| SMILES | FC(F)(F)c1nn(C2CCC3(CC2)OCCO3)cc1Br |
| InChI | InChI=1S/C12H14BrF3N2O2/c13-9-7-18(17-10(9)12(14,15)16)8-1-3-11(4-2-8)19-5-6-20-11/h7-8H,1-6H2 |
| InChIKey | SZILNIPRXCEQBT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.15 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-bromo-1-(1,4-dioxaspiro[4.5]decan-8-yl)-3-(trifluoromethyl)pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1-(1,4-dioxaspiro[4.5]decan-8-yl)-3-(trifluoromethyl)pyrazole?
The IUPAC name of 4-bromo-1-(1,4-dioxaspiro[4.5]decan-8-yl)-3-(trifluoromethyl)pyrazole (CID 58516047) is 4-bromo-1-(1,4-dioxaspiro[4.5]decan-8-yl)-3-(trifluoromethyl)pyrazole.
What is the SMILES notation for 4-bromo-1-(1,4-dioxaspiro[4.5]decan-8-yl)-3-(trifluoromethyl)pyrazole?
The canonical SMILES for 4-bromo-1-(1,4-dioxaspiro[4.5]decan-8-yl)-3-(trifluoromethyl)pyrazole is FC(F)(F)c1nn(C2CCC3(CC2)OCCO3)cc1Br.
What is the InChIKey of 4-bromo-1-(1,4-dioxaspiro[4.5]decan-8-yl)-3-(trifluoromethyl)pyrazole?
The InChIKey is SZILNIPRXCEQBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14BrF3N2O2/c13-9-7-18(17-10(9)12(14,15)16)8-1-3-11(4-2-8)19-5-6-20-11/h7-8H,1-6H2.
What are the key properties of 4-bromo-1-(1,4-dioxaspiro[4.5]decan-8-yl)-3-(trifluoromethyl)pyrazole?
4-bromo-1-(1,4-dioxaspiro[4.5]decan-8-yl)-3-(trifluoromethyl)pyrazole has a molecular weight of 355.15 g/mol, XLogP of 3.52, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1-(1,4-dioxaspiro[4.5]decan-8-yl)-3-(trifluoromethyl)pyrazole is sourced from PubChem (CID 58516047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).