C17H16ClFO5S — CID 58516130
2-[2-[(2-chloro-4-ethylsulfonylphenyl)methyl]-4-fluorophenoxy]acetic acid (PubChem CID 58516130) has the molecular formula C17H16ClFO5S and a molecular weight of 386.83 g/mol. Its IUPAC name is 2-[2-[(2-chloro-4-ethylsulfonylphenyl)methyl]-4-fluorophenoxy]acetic acid.
| Compound Name | 2-[2-[(2-chloro-4-ethylsulfonylphenyl)methyl]-4-fluorophenoxy]acetic acid |
|---|---|
| PubChem CID | 58516130 |
| Molecular Formula | C17H16ClFO5S |
| Molecular Weight | 386.83 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | 2-[2-[(2-chloro-4-ethylsulfonylphenyl)methyl]-4-fluorophenoxy]acetic acid |
| SMILES | CCS(=O)(=O)c1ccc(Cc2cc(F)ccc2OCC(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C17H16ClFO5S/c1-2-25(22,23)14-5-3-11(15(18)9-14)7-12-8-13(19)4-6-16(12)24-10-17(20)21/h3-6,8-9H,2,7,10H2,1H3,(H,20,21) |
| InChIKey | AGYBVLCHYLIYTD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.83 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |