C19H20ClFO5S — CID 58516144
2-[2-[(2-chloro-4-ethylsulfonylphenyl)methyl]-4-fluorophenoxy]-2-methylpropanoic acid (PubChem CID 58516144) has the molecular formula C19H20ClFO5S and a molecular weight of 414.88 g/mol. Its IUPAC name is 2-[2-[(2-chloro-4-ethylsulfonylphenyl)methyl]-4-fluorophenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[2-[(2-chloro-4-ethylsulfonylphenyl)methyl]-4-fluorophenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 58516144 |
| Molecular Formula | C19H20ClFO5S |
| Molecular Weight | 414.88 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | 2-[2-[(2-chloro-4-ethylsulfonylphenyl)methyl]-4-fluorophenoxy]-2-methylpropanoic acid |
| SMILES | CCS(=O)(=O)c1ccc(Cc2cc(F)ccc2OC(C)(C)C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C19H20ClFO5S/c1-4-27(24,25)15-7-5-12(16(20)11-15)9-13-10-14(21)6-8-17(13)26-19(2,3)18(22)23/h5-8,10-11H,4,9H2,1-3H3,(H,22,23) |
| InChIKey | CUNFMVFEUQIBIE-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.88 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |