C24H30N4 — CID 58516338
2-cyclopentyl-5-[2-[4-[2-[(2S)-pyrrolidin-2-yl]-3H-pyrrol-4-yl]phenyl]ethyl]-1H-imidazole (PubChem CID 58516338) has the molecular formula C24H30N4 and a molecular weight of 374.53 g/mol. Its IUPAC name is 2-cyclopentyl-5-[2-[4-[2-[(2S)-pyrrolidin-2-yl]-3H-pyrrol-4-yl]phenyl]ethyl]-1H-imidazole.
| Compound Name | 2-cyclopentyl-5-[2-[4-[2-[(2S)-pyrrolidin-2-yl]-3H-pyrrol-4-yl]phenyl]ethyl]-1H-imidazole |
|---|---|
| PubChem CID | 58516338 |
| Molecular Formula | C24H30N4 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | 2-cyclopentyl-5-[2-[4-[2-[(2S)-pyrrolidin-2-yl]-3H-pyrrol-4-yl]phenyl]ethyl]-1H-imidazole |
| SMILES | C1=C(c2ccc(CCc3cnc(C4CCCC4)[nH]3)cc2)CC([C@@H]2CCCN2)=N1 |
| InChI | InChI=1S/C24H30N4/c1-2-5-19(4-1)24-27-16-21(28-24)12-9-17-7-10-18(11-8-17)20-14-23(26-15-20)22-6-3-13-25-22/h7-8,10-11,15-16,19,22,25H,1-6,9,12-14H2,(H,27,28)/t22-/m0/s1 |
| InChIKey | HUJFYJGXLWUXCX-QFIPXVFZSA-N |
| XLogP | 4.79 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |