C18H28O5 — CID 58516355
[(3Z,6S,7S,8E)-7-methoxy-3,5-dimethyl-14-oxo-1-oxacyclotetradeca-3,8-dien-6-yl] acetate (PubChem CID 58516355) has the molecular formula C18H28O5 and a molecular weight of 324.42 g/mol. Its IUPAC name is [(3Z,6S,7S,8E)-7-methoxy-3,5-dimethyl-14-oxo-1-oxacyclotetradeca-3,8-dien-6-yl] acetate.
| Compound Name | [(3Z,6S,7S,8E)-7-methoxy-3,5-dimethyl-14-oxo-1-oxacyclotetradeca-3,8-dien-6-yl] acetate |
|---|---|
| PubChem CID | 58516355 |
| Molecular Formula | C18H28O5 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | [(3Z,6S,7S,8E)-7-methoxy-3,5-dimethyl-14-oxo-1-oxacyclotetradeca-3,8-dien-6-yl] acetate |
| SMILES | CO[C@H]1/C=C/CCCCC(=O)OC/C(C)=C\C(C)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H28O5/c1-13-11-14(2)18(23-15(3)19)16(21-4)9-7-5-6-8-10-17(20)22-12-13/h7,9,11,14,16,18H,5-6,8,10,12H2,1-4H3/b9-7+,13-11-/t14?,16-,18-/m0/s1 |
| InChIKey | WFPVEIRUOXVMMH-IVVRQPDRSA-N |
| XLogP | 3.19 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|