C28H43NO — CID 58516483
2-[(1R)-3-[butan-2-yl(propan-2-yl)amino]-1,2,2,3,3-pentadeuterio-1-(2,3-dimethylphenyl)propyl]-5-methyl-4-propan-2-ylphenol (PubChem CID 58516483) has the molecular formula C28H43NO and a molecular weight of 414.69 g/mol. Its IUPAC name is 2-[(1R)-3-[butan-2-yl(propan-2-yl)amino]-1,2,2,3,3-pentadeuterio-1-(2,3-dimethylphenyl)propyl]-5-methyl-4-propan-2-ylphenol.
| Compound Name | 2-[(1R)-3-[butan-2-yl(propan-2-yl)amino]-1,2,2,3,3-pentadeuterio-1-(2,3-dimethylphenyl)propyl]-5-methyl-4-propan-2-ylphenol |
|---|---|
| PubChem CID | 58516483 |
| Molecular Formula | C28H43NO |
| Molecular Weight | 414.69 g/mol |
| Exact Mass | 414.37 |
| IUPAC Name | 2-[(1R)-3-[butan-2-yl(propan-2-yl)amino]-1,2,2,3,3-pentadeuterio-1-(2,3-dimethylphenyl)propyl]-5-methyl-4-propan-2-ylphenol |
| SMILES | [2H]C([2H])(N(C(C)C)C(C)CC)C([2H])([2H])[C@@]([2H])(c1cc(C(C)C)c(C)cc1O)c1cccc(C)c1C |
| InChI | InChI=1S/C28H43NO/c1-10-22(8)29(19(4)5)15-14-25(24-13-11-12-20(6)23(24)9)27-17-26(18(2)3)21(7)16-28(27)30/h11-13,16-19,22,25,30H,10,14-15H2,1-9H3/t22?,25-/m1/s1/i14D2,15D2,25D |
| InChIKey | WXPIYHHUGWRURZ-YKFVVRMPSA-N |
| XLogP | 7.47 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.69 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |